CAS 60719-83-7 appears in our catalog under these names: Alaproclate Hydrochloride, Alaproclate (hydrochloride), Alaproclate (hydrochloride), Alaproclate hydrochloride, 97%, 97%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 5mg, 10mg, 1mg, 5 mg.
[1-(4-chlorophenyl)-2-methylpropan-2-yl] 2-aminopropanoate;hydrochloride (CAS 60719-83-7) is a chemical compound with the molecular formula C13H19Cl2NO2 and a molecular weight of 292.20 g/mol. IUPAC name: [1-(4-chlorophenyl)-2-methylpropan-2-yl] 2-aminopropanoate;hydrochloride. InChIKey: OPAKSOWFKIUFNP-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2NO2 |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | [1-(4-chlorophenyl)-2-methylpropan-2-yl] 2-aminopropanoate;hydrochloride |
| InChIKey | OPAKSOWFKIUFNP-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC(C)(C)CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)