CAS 1060980-53-1 appears in our catalog under these names: tert-Butyl 8-methyl-1,3,4,5-tetrahydro-2h-pyrido[4,3-b]indole-2-carboxylate, 95%, tert-Butyl 8-methyl-1,3,4,5-tetrahydro-2H-pyrido(4,3-b)indole-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl 8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (CAS 1060980-53-1) is a chemical compound with the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. IUPAC name: tert-butyl 8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: DPZVCTUREBJLTG-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O2 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | tert-butyl 8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| InChIKey | DPZVCTUREBJLTG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)