CAS 99430-77-0 appears in our catalog under these names: Doxylamine Pyridine N-Oxide, Doxylamine Impurity 6, Doxylamine Impurity 5, Doxylamine N'-Oxide, >95% (HPLC), Doxylamine N’-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dimethyl-2-[1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethoxy]ethanamine (CAS 99430-77-0) is a chemical compound with the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. IUPAC name: N,N-dimethyl-2-[1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethoxy]ethanamine. InChIKey: MDIHSMRZIRBUPR-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O2 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | N,N-dimethyl-2-[1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethoxy]ethanamine |
| InChIKey | MDIHSMRZIRBUPR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=[N+]2[O-])OCCN(C)C |
Computed by PubChem (NCBI)