CAS 35121-60-9 appears in our catalog under these names: Nicergoline Impurity 1, Nicergoline Impurity 11, 10Alpha-Methoxy-9,10-dihydrolysergol, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
[(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol (CAS 35121-60-9) is a chemical compound with the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. IUPAC name: [(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol. InChIKey: JGQZSBLQHCTAJF-JGFGOQIWSA-N.
| Molecular formula | C17H22N2O2 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | [(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol |
| InChIKey | JGQZSBLQHCTAJF-JGFGOQIWSA-N |
| SMILES | CN1C[C@@H](C[C@]2([C@H]1CC3=CNC4=CC=CC2=C34)OC)CO |
Computed by PubChem (NCBI)