Products 106141-17-7
CAS 106141-17-7 is the registry number for 1-(2-Hydroxy-3,5-dimethylphenyl)-2-methylpropan-1-one, 95%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-(2-hydroxy-3,5-dimethylphenyl)-2-methylpropan-1-one (CAS 106141-17-7) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-(2-hydroxy-3,5-dimethylphenyl)-2-methylpropan-1-one. InChIKey: MDHGFOBMXFKZBB-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-(2-hydroxy-3,5-dimethylphenyl)-2-methylpropan-1-one |
| InChIKey | MDHGFOBMXFKZBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)C(C)C)O)C |
Computed by PubChem (NCBI)