CAS 106174-98-5 is the registry number for Stiripentol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4-dihydroxyphenyl)-1-hydroxy-2,2-dimethylpentan-3-one (CAS 106174-98-5) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 5-(3,4-dihydroxyphenyl)-1-hydroxy-2,2-dimethylpentan-3-one. InChIKey: JJMIDXCHAJNVNC-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 5-(3,4-dihydroxyphenyl)-1-hydroxy-2,2-dimethylpentan-3-one |
| InChIKey | JJMIDXCHAJNVNC-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(=O)CCC1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)