CAS 106220-89-7 appears in our catalog under these names: Methyl 6-O-benzyl-2,3-di-O-methyl-a-D-glucopyranoside, 98%, Methyl 6-O-benzyl-2,3-di-O-methyl-a-D-glucopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50g, 25g, 100g, 500g, 250g.
(2R,3R,4S,5R,6S)-4,5,6-trimethoxy-2-(phenylmethoxymethyl)oxan-3-ol (CAS 106220-89-7) is a chemical compound with the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-4,5,6-trimethoxy-2-(phenylmethoxymethyl)oxan-3-ol. InChIKey: APZUEGZIJXFXRZ-LJIZCISZSA-N.
| Molecular formula | C16H24O6 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-4,5,6-trimethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
| InChIKey | APZUEGZIJXFXRZ-LJIZCISZSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](O[C@@H]([C@@H]1OC)OC)COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)