CAS 127457-64-1 appears in our catalog under these names: Benzyl-peg4-acid, 95%, Benzyl–PEG4–acid, 14-Phenyl-4,7,10,13-tetraoxatetradecanoic acid, 98%, 98%, Benzyl-PEG4-acid, 98.0%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100 mg.
3-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]propanoic acid (CAS 127457-64-1) is a chemical compound with the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. IUPAC name: 3-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: FGLPTVPWFDQWFM-UHFFFAOYSA-N.
| Molecular formula | C16H24O6 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | 3-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | FGLPTVPWFDQWFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)