Products 22248-41-5
CAS 22248-41-5 appears in our catalog under these names: (-)-Pyrenophorol, Pyrenophorol. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 500ug, 1 mg.
(3E,5S,8R,11E,13S,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione (CAS 22248-41-5) is a chemical compound with the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. IUPAC name: (3E,5S,8R,11E,13S,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione. InChIKey: RBQNDQOKFICJGL-UTBFYLPBSA-N.
| Molecular formula | C16H24O6 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | (3E,5S,8R,11E,13S,16R)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
| InChIKey | RBQNDQOKFICJGL-UTBFYLPBSA-N |
| SMILES | C[C@H]1OC(=O)/C=C/[C@H](CC[C@H](OC(=O)/C=C/[C@H](CC1)O)C)O |
Computed by PubChem (NCBI)