Products 1062648-63-8
CAS 1062648-63-8 appears in our catalog under these names: DMT1 blocker 2/ 99.65% (existing batch purity), DMT1 blocker 2, DMT1 blocker 2, 99.93%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 100 mg.
2-pyridin-2-yl-4,5-dihydro-3H-benzo[e]indazol-1-one (CAS 1062648-63-8) is a chemical compound with the molecular formula C16H13N3O and a molecular weight of 263.29 g/mol. IUPAC name: 2-pyridin-2-yl-4,5-dihydro-3H-benzo[e]indazol-1-one. InChIKey: BKZBNMNLRQXSHY-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-pyridin-2-yl-4,5-dihydro-3H-benzo[e]indazol-1-one |
| InChIKey | BKZBNMNLRQXSHY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)C(=O)N(N2)C4=CC=CC=N4 |
Computed by PubChem (NCBI)