CAS 745761-19-7 is the registry number for Epinastine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-13-one (CAS 745761-19-7) is a chemical compound with the molecular formula C16H13N3O and a molecular weight of 263.29 g/mol. IUPAC name: 3-amino-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-13-one. InChIKey: ZLEUIRBHHWJTHP-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 3-amino-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-13-one |
| InChIKey | ZLEUIRBHHWJTHP-UHFFFAOYSA-N |
| SMILES | C1C2C3=CC=CC=C3C(=O)C4=CC=CC=C4N2C(=N1)N |
Computed by PubChem (NCBI)