CAS 2253719-35-4 appears in our catalog under these names: SY-LB-57, SY–LB–57, SY-LB-57, 99%, 99%, SY-LB-57, 99.66%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 50mg, 5mg, 10mM/1mL, 10 mg.
2-(5-methoxy-1H-indol-2-yl)-1H-benzimidazole (CAS 2253719-35-4) is a chemical compound with the molecular formula C16H13N3O and a molecular weight of 263.29 g/mol. IUPAC name: 2-(5-methoxy-1H-indol-2-yl)-1H-benzimidazole. InChIKey: CKMZAHNTGUKLJF-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-(5-methoxy-1H-indol-2-yl)-1H-benzimidazole |
| InChIKey | CKMZAHNTGUKLJF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)