CAS 106350-23-6 is the registry number for Methyl 8-amino-5-chloro-2,3-dihydroimidazo[1,2-c]pyrimidine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 8-amino-5-chloro-2,3-dihydroimidazo[1,2-c]pyrimidine-7-carboxylate (CAS 106350-23-6) is a chemical compound with the molecular formula C8H9ClN4O2 and a molecular weight of 228.63 g/mol. IUPAC name: methyl 8-amino-5-chloro-2,3-dihydroimidazo[1,2-c]pyrimidine-7-carboxylate. InChIKey: AMYZETODLXYMKK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O2 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | methyl 8-amino-5-chloro-2,3-dihydroimidazo[1,2-c]pyrimidine-7-carboxylate |
| InChIKey | AMYZETODLXYMKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=NCCN2C(=N1)Cl)N |
Computed by PubChem (NCBI)