CAS 1609400-91-0 is the registry number for 5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride (CAS 1609400-91-0) is a chemical compound with the molecular formula C8H9ClN4O2 and a molecular weight of 228.63 g/mol. IUPAC name: 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride. InChIKey: UJLMZWGPSTUXJI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O2 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride |
| InChIKey | UJLMZWGPSTUXJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)C(=O)O)C.Cl |
Computed by PubChem (NCBI)