CAS 4921-49-7 appears in our catalog under these names: Dimenhydrinate EP Impurity E, Dimenhydrinate Impurity 5 (Dimenhydrinate EP Impurity E), 8-Chloro Caffeine, >95% (HPLC), 8-Chloro-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione (8-Chlorocaffeine), 8–chloro Caffeine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 1g.
8-chloro-1,3,7-trimethylpurine-2,6-dione (CAS 4921-49-7) is a chemical compound with the molecular formula C8H9ClN4O2 and a molecular weight of 228.63 g/mol. IUPAC name: 8-chloro-1,3,7-trimethylpurine-2,6-dione. InChIKey: HGKPGBJNNATDRR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O2 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 8-chloro-1,3,7-trimethylpurine-2,6-dione |
| InChIKey | HGKPGBJNNATDRR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1Cl)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)