Products 1063655-77-5
CAS 1063655-77-5 is the registry number for 1-((4-methylcyclohexyl)oxy)-4-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-methylcyclohexyl)oxy-4-nitrobenzene (CAS 1063655-77-5) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 1-(4-methylcyclohexyl)oxy-4-nitrobenzene. InChIKey: JWNQBOBQKAROEG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-(4-methylcyclohexyl)oxy-4-nitrobenzene |
| InChIKey | JWNQBOBQKAROEG-UHFFFAOYSA-N |
| SMILES | CC1CCC(CC1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)