CAS 106391-24-6 appears in our catalog under these names: Cytosine-5,6-d2, >95% (HPLC), Cytosine–d2, Cytosine-5,6-d2, Cytosine-d2, 99.69%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 25mg, 5mg, 50mg, 50 mg, 10 mg.
6-amino-4,5-dideuterio-1H-pyrimidin-2-one (CAS 106391-24-6) is a chemical compound with the molecular formula C4H5N3O and a molecular weight of 113.11 g/mol. IUPAC name: 6-amino-4,5-dideuterio-1H-pyrimidin-2-one. InChIKey: OPTASPLRGRRNAP-QDNHWIQGSA-N.
| Molecular formula | C4H5N3O |
|---|---|
| Molecular weight | 113.11 g/mol |
| IUPAC name | 6-amino-4,5-dideuterio-1H-pyrimidin-2-one |
| InChIKey | OPTASPLRGRRNAP-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(NC(=O)N=C1[2H])N |
Computed by PubChem (NCBI)