CAS 181517-10-2 appears in our catalog under these names: Cytosine–13C,15N2, Cytosine-13C-15N2, Cytosine-13C,15N2, 98%. Offered by: GLPBio, Chemat Brand, MedChemExpress. Available pack sizes: 10mg, on request, 1mg, 25mg, 5mg, 5 mg, 1 mg, 10 mg.
6-amino-(213C,1,3-15N2)1H-pyrimidin-2-one (CAS 181517-10-2) is a chemical compound with the molecular formula C4H5N3O and a molecular weight of 114.08 g/mol. IUPAC name: 6-amino-(213C,1,3-15N2)1H-pyrimidin-2-one. InChIKey: OPTASPLRGRRNAP-XZQGXACKSA-N.
| Molecular formula | C4H5N3O |
|---|---|
| Molecular weight | 114.08 g/mol |
| IUPAC name | 6-amino-(213C,1,3-15N2)1H-pyrimidin-2-one |
| InChIKey | OPTASPLRGRRNAP-XZQGXACKSA-N |
| SMILES | C1=C([15NH][13C](=O)[15N]=C1)N |
Computed by PubChem (NCBI)