Products 285978-06-5
CAS 285978-06-5 appears in our catalog under these names: Cytosine-13C2,15N3, Cytosine–13C2,15N2, CYTOSINE-2,4-13C2-15N3, 99 ATOM % 13C, &. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg.
6-(15N)azanyl-(2,6-13C2,1,3-15N2)1H-pyrimidin-2-one (CAS 285978-06-5) is a chemical compound with the molecular formula C4H5N3O and a molecular weight of 116.07 g/mol. IUPAC name: 6-(15N)azanyl-(2,6-13C2,1,3-15N2)1H-pyrimidin-2-one. InChIKey: OPTASPLRGRRNAP-SLOBMOILSA-N.
| Molecular formula | C4H5N3O |
|---|---|
| Molecular weight | 116.07 g/mol |
| IUPAC name | 6-(15N)azanyl-(2,6-13C2,1,3-15N2)1H-pyrimidin-2-one |
| InChIKey | OPTASPLRGRRNAP-SLOBMOILSA-N |
| SMILES | C1=[13C]([15NH][13C](=O)[15N]=C1)[15NH2] |
Computed by PubChem (NCBI)