Products 1063961-19-2

CAS 1063961-19-2 is the registry number for 1-cyclobutyl-3,5-dimethoxybenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-cyclobutyl-3,5-dimethoxybenzene (CAS 1063961-19-2) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-cyclobutyl-3,5-dimethoxybenzene. InChIKey: XIHIFCRUOAVSNC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name1-cyclobutyl-3,5-dimethoxybenzene
InChIKeyXIHIFCRUOAVSNC-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C2CCC2)OC

Computed by PubChem (NCBI)