Products 1065075-76-4

CAS 1065075-76-4 is the registry number for 4-(Dimethylamino)-2-(methylthio)pyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

4-(dimethylamino)-2-methylsulfanylpyrimidine-5-carboxylic acid (CAS 1065075-76-4) is a chemical compound with the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. IUPAC name: 4-(dimethylamino)-2-methylsulfanylpyrimidine-5-carboxylic acid. InChIKey: FOIJKEKGYNMKBR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11N3O2S
Molecular weight213.26 g/mol
IUPAC name4-(dimethylamino)-2-methylsulfanylpyrimidine-5-carboxylic acid
InChIKeyFOIJKEKGYNMKBR-UHFFFAOYSA-N
SMILESCN(C)C1=NC(=NC=C1C(=O)O)SC

Computed by PubChem (NCBI)