Products 1860673-66-0
CAS 1860673-66-0 is the registry number for 5-((Thietan-3-ylamino)methyl)isoxazole-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(thietan-3-ylamino)methyl]-1,2-oxazole-3-carboxamide (CAS 1860673-66-0) is a chemical compound with the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. IUPAC name: 5-[(thietan-3-ylamino)methyl]-1,2-oxazole-3-carboxamide. InChIKey: OWVKOOHCALTMQQ-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 5-[(thietan-3-ylamino)methyl]-1,2-oxazole-3-carboxamide |
| InChIKey | OWVKOOHCALTMQQ-UHFFFAOYSA-N |
| SMILES | C1C(CS1)NCC2=CC(=NO2)C(=O)N |
Computed by PubChem (NCBI)