CAS 1854831-13-2 is the registry number for 3-((6-Aminopyridin-3-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine (CAS 1854831-13-2) is a chemical compound with the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. IUPAC name: 5-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine. InChIKey: GXOTUGXBDCOKNU-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 5-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine |
| InChIKey | GXOTUGXBDCOKNU-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=CN=C(C=C2)N |
Computed by PubChem (NCBI)