CAS 106539-14-4 is the registry number for Methyl (S)-3-Boc-aminobutyrate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 106539-14-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: SUHJJLDEYCLBFT-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | methyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | SUHJJLDEYCLBFT-ZETCQYMHSA-N |
| SMILES | C[C@@H](CC(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)