CAS 1065586-37-9 is the registry number for 1-(2,4-Difluorobenzoyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(2,4-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1065586-37-9) is a chemical compound with the molecular formula C11H13ClF2N2O and a molecular weight of 262.68 g/mol. IUPAC name: (2,4-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: GOKZJHFFNFROOW-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF2N2O |
|---|---|
| Molecular weight | 262.68 g/mol |
| IUPAC name | (2,4-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | GOKZJHFFNFROOW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)