CAS 1580741-84-9 appears in our catalog under these names: 1-(3,5-Difluorobenzoyl)piperazine hydrochloride, 97%, 1-(3,5-Difluorobenzoyl)piperazine hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 5g, 250mg, 500mg, 1g.
(3,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1580741-84-9) is a chemical compound with the molecular formula C11H13ClF2N2O and a molecular weight of 262.68 g/mol. IUPAC name: (3,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: VPGWGIRTDGAURR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF2N2O |
|---|---|
| Molecular weight | 262.68 g/mol |
| IUPAC name | (3,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | VPGWGIRTDGAURR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)