CAS 1221724-79-3 appears in our catalog under these names: 1-[(2,5-Difluorophenyl)carbonyl]piperazine hydrochloride, 95%, (2,5-Difluorophenyl)(piperazin-1-yl)methanone hydrochloride, 98%, 1-(2,5-Difluorobenzoyl)piperazine hydrochloride, (2,5-Difluorophenyl)(piperazin-1-yl)methanone hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 2,5g.
(2,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1221724-79-3) is a chemical compound with the molecular formula C11H13ClF2N2O and a molecular weight of 262.68 g/mol. IUPAC name: (2,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: OXMSLWOUSHKMCM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF2N2O |
|---|---|
| Molecular weight | 262.68 g/mol |
| IUPAC name | (2,5-difluorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | OXMSLWOUSHKMCM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=C(C=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)