CAS 106614-66-8 appears in our catalog under these names: Amorolfine EP Impurity F, 1-(4-(Tert-pentyl)phenyl)propan-1-one, 98%, 1-(4-(tert-Pentyl)phenyl)propan-1-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1-[4-(2-methylbutan-2-yl)phenyl]propan-1-one (CAS 106614-66-8) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-[4-(2-methylbutan-2-yl)phenyl]propan-1-one. InChIKey: BYPHHFPLNRCWDW-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-[4-(2-methylbutan-2-yl)phenyl]propan-1-one |
| InChIKey | BYPHHFPLNRCWDW-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)C(C)(C)CC |
Computed by PubChem (NCBI)