CAS 1066676-21-8 is the registry number for HCAR2 agonist 1, 99.11%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 10 mg, 50 mg, 25 mg, 5 mg, 100 mg.
7-methyl-N-[(2R)-1-phenoxypropan-2-yl]-3-(4-propan-2-ylphenyl)pyrazolo[1,5-a]pyrimidine-6-carboxamide (CAS 1066676-21-8) is a chemical compound with the molecular formula C26H28N4O2 and a molecular weight of 428.5 g/mol. IUPAC name: 7-methyl-N-[(2R)-1-phenoxypropan-2-yl]-3-(4-propan-2-ylphenyl)pyrazolo[1,5-a]pyrimidine-6-carboxamide. InChIKey: DJSWNINDPRRCLC-GOSISDBHSA-N.
| Molecular formula | C26H28N4O2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 7-methyl-N-[(2R)-1-phenoxypropan-2-yl]-3-(4-propan-2-ylphenyl)pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| InChIKey | DJSWNINDPRRCLC-GOSISDBHSA-N |
| SMILES | CC1=C(C=NC2=C(C=NN12)C3=CC=C(C=C3)C(C)C)C(=O)N[C@H](C)COC4=CC=CC=C4 |
Computed by PubChem (NCBI)