Products 932013-08-6
CAS 932013-08-6 appears in our catalog under these names: Rhodamine 6G hydrazide, Rhodamine 6G hydrazide, 98%, 98%, Rhodamine 6G hydrazide, 98.05%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 25 mg, 5 mg, 10 mg, 50 mg.
2-amino-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (CAS 932013-08-6) is a chemical compound with the molecular formula C26H28N4O2 and a molecular weight of 428.5 g/mol. IUPAC name: 2-amino-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one. InChIKey: QUMMHDKUYXGXQJ-UHFFFAOYSA-N.
| Molecular formula | C26H28N4O2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 2-amino-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | QUMMHDKUYXGXQJ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C=C1C)C3(C4=CC=CC=C4C(=O)N3N)C5=C(O2)C=C(C(=C5)C)NCC |
Computed by PubChem (NCBI)