Products 1333231-26-7
CAS 1333231-26-7 is the registry number for N3-L-Lys(Mtt)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 500mg, Get quote.
(2S)-2-azido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid (CAS 1333231-26-7) is a chemical compound with the molecular formula C26H28N4O2 and a molecular weight of 428.5 g/mol. IUPAC name: (2S)-2-azido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid. InChIKey: KBXSFBJXJSKJBY-DEOSSOPVSA-N.
| Molecular formula | C26H28N4O2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | (2S)-2-azido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
| InChIKey | KBXSFBJXJSKJBY-DEOSSOPVSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)