CAS 106685-36-3 is the registry number for 6-(3,4-Dimethoxyphenyl)-2-naphthalenecarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-(3,4-dimethoxyphenyl)naphthalene-2-carboxylic acid (CAS 106685-36-3) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 308.3 g/mol. IUPAC name: 6-(3,4-dimethoxyphenyl)naphthalene-2-carboxylic acid. InChIKey: IICAATBTLIACJN-UHFFFAOYSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 6-(3,4-dimethoxyphenyl)naphthalene-2-carboxylic acid |
| InChIKey | IICAATBTLIACJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=C(C=C2)C=C(C=C3)C(=O)O)OC |
Computed by PubChem (NCBI)