CAS 75472-93-4 appears in our catalog under these names: Warfarin-d5, Warfarin-d5, >95% (HPLC), (±)-Warfarin D5 (phenyl D5), (±)-Warfarin D5 (phenyl D5) 100 µg/mL in Acetonitrile, (±)-Warfarin-d5 (phenyl-d5), 99 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, CDN. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-hydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 75472-93-4) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 313.4 g/mol. IUPAC name: 4-hydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: PJVWKTKQMONHTI-ATTUOBAHSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 4-hydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | PJVWKTKQMONHTI-ATTUOBAHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC(=O)C)C2=C(C3=CC=CC=C3OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)