Products 791013-22-4
CAS 791013-22-4 appears in our catalog under these names: (S)-Warfarin-d5, S-(-)-Warfarin-d5, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-hydroxy-3-[(1S)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 791013-22-4) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 313.4 g/mol. IUPAC name: 4-hydroxy-3-[(1S)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: PJVWKTKQMONHTI-BXGYBMFISA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 4-hydroxy-3-[(1S)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | PJVWKTKQMONHTI-BXGYBMFISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@H](CC(=O)C)C2=C(C3=CC=CC=C3OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)