Products 1067214-81-6
CAS 1067214-81-6 is the registry number for GSK-7227. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[3-(5-methoxy-4-methylindol-1-yl)sulfonylbenzoyl]amino]-5-methylbenzoic acid (CAS 1067214-81-6) is a chemical compound with the molecular formula C25H22N2O6S and a molecular weight of 478.5 g/mol. IUPAC name: 2-[[3-(5-methoxy-4-methylindol-1-yl)sulfonylbenzoyl]amino]-5-methylbenzoic acid. InChIKey: LYXBTAXWNCLYLA-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O6S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 2-[[3-(5-methoxy-4-methylindol-1-yl)sulfonylbenzoyl]amino]-5-methylbenzoic acid |
| InChIKey | LYXBTAXWNCLYLA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC(=CC=C2)S(=O)(=O)N3C=CC4=C3C=CC(=C4C)OC)C(=O)O |
Computed by PubChem (NCBI)