CAS 476639-82-4 is the registry number for Fmoc-Cys(S-oNBn)-OH, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-nitrophenyl)methylsulfanyl]propanoic acid (CAS 476639-82-4) is a chemical compound with the molecular formula C25H22N2O6S and a molecular weight of 478.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-nitrophenyl)methylsulfanyl]propanoic acid. InChIKey: SVOGGMQXNDVNFR-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O6S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-nitrophenyl)methylsulfanyl]propanoic acid |
| InChIKey | SVOGGMQXNDVNFR-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)CSC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[N+](=O)[O-] |
Computed by PubChem (NCBI)