Products 2955083-85-7
CAS 2955083-85-7 is the registry number for Keap1-Nrf2-IN-22. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-[carboxymethyl(naphthalen-2-ylsulfonyl)amino]phenyl]-1-ethylpyrrole-2-carboxylic acid (CAS 2955083-85-7) is a chemical compound with the molecular formula C25H22N2O6S and a molecular weight of 478.5 g/mol. IUPAC name: 5-[3-[carboxymethyl(naphthalen-2-ylsulfonyl)amino]phenyl]-1-ethylpyrrole-2-carboxylic acid. InChIKey: RXXRYPRPQYPBOC-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O6S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 5-[3-[carboxymethyl(naphthalen-2-ylsulfonyl)amino]phenyl]-1-ethylpyrrole-2-carboxylic acid |
| InChIKey | RXXRYPRPQYPBOC-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC=C1C(=O)O)C2=CC(=CC=C2)N(CC(=O)O)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)
Synonyms:
Keap1-Nrf2-IN-22, orb2665078