CAS 106730-62-5 is the registry number for Olprinone Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxamide (CAS 106730-62-5) is a chemical compound with the molecular formula C14H12N4O2 and a molecular weight of 268.27 g/mol. IUPAC name: 5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxamide. InChIKey: MMFIHYRULIVHCJ-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O2 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | MMFIHYRULIVHCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C(=O)N)C2=CN3C=CN=C3C=C2 |
Computed by PubChem (NCBI)