CAS 954264-63-2 is the registry number for 1,3-Dimethyl-6-(pyridin-3-yl)-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1,3-dimethyl-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 954264-63-2) is a chemical compound with the molecular formula C14H12N4O2 and a molecular weight of 268.27 g/mol. IUPAC name: 1,3-dimethyl-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: PWJKXCJMWFWZHK-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O2 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 1,3-dimethyl-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | PWJKXCJMWFWZHK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CN=CC=C3)C(=O)O)C |
Computed by PubChem (NCBI)