Products 1206969-97-2

CAS 1206969-97-2 is the registry number for 3-(Benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid (CAS 1206969-97-2) is a chemical compound with the molecular formula C14H12N4O2 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid. InChIKey: UPVMFGJTIXRIRG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N4O2
Molecular weight268.27 g/mol
IUPAC name3-(benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
InChIKeyUPVMFGJTIXRIRG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC2=NN=C3N2C=CC=C3C(=O)O

Computed by PubChem (NCBI)