CAS 106763-32-0 is the registry number for cis-2,6-Dimethylpiperazine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S,6R)-2,6-dimethylpiperazine;dihydrochloride (CAS 106763-32-0) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: (2S,6R)-2,6-dimethylpiperazine;dihydrochloride. InChIKey: SFOYHYMXNYOPAI-RUTFAPCESA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethylpiperazine;dihydrochloride |
| InChIKey | SFOYHYMXNYOPAI-RUTFAPCESA-N |
| SMILES | C[C@@H]1CNC[C@@H](N1)C.Cl.Cl |
Computed by PubChem (NCBI)