CAS 162240-93-9 appears in our catalog under these names: (2R,6R)-2,6-Dimethylpiperazine dihydrochloride, 97%, 97%, (2R,6R)-2,6-Dimethylpiperazine dihydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2R,6R)-2,6-dimethylpiperazine;dihydrochloride (CAS 162240-93-9) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperazine;dihydrochloride. InChIKey: SFOYHYMXNYOPAI-BNTLRKBRSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | (2R,6R)-2,6-dimethylpiperazine;dihydrochloride |
| InChIKey | SFOYHYMXNYOPAI-BNTLRKBRSA-N |
| SMILES | C[C@@H]1CNC[C@H](N1)C.Cl.Cl |
Computed by PubChem (NCBI)