CAS 1067902-28-6 appears in our catalog under these names: Benzyl 6-chloronicotinate 98%, Benzyl 6-chloropyridine-3-carboxylate. Offered by: Ambeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g.
Benzyl 6-chloropyridine-3-carboxylate (CAS 1067902-28-6) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: benzyl 6-chloropyridine-3-carboxylate. InChIKey: MEXMCDINMYSBTD-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | benzyl 6-chloropyridine-3-carboxylate |
| InChIKey | MEXMCDINMYSBTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)