CAS 1068439-32-6 is the registry number for 5,6-Dimethoxy-1-(phenylsulfonyl)-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-5,6-dimethoxyindole (CAS 1068439-32-6) is a chemical compound with the molecular formula C16H15NO4S and a molecular weight of 317.4 g/mol. IUPAC name: 1-(benzenesulfonyl)-5,6-dimethoxyindole. InChIKey: UGWHIQRVGWUWLX-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5,6-dimethoxyindole |
| InChIKey | UGWHIQRVGWUWLX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN2S(=O)(=O)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)