CAS 326619-13-0 appears in our catalog under these names: 3-(2-Methyl-2,3-dihydro-indole-1-sulfonyl)-benzoic acid, 95%, 3-((2-Methyl-2,3-dihydro-1H-indol-1-yl)sulfonyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoic acid (CAS 326619-13-0) is a chemical compound with the molecular formula C16H15NO4S and a molecular weight of 317.4 g/mol. IUPAC name: 3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoic acid. InChIKey: XNIBPBAYVBMMHE-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoic acid |
| InChIKey | XNIBPBAYVBMMHE-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC=CC=C2N1S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)