Products 412268-99-6
CAS 412268-99-6 is the registry number for 3-(3-Phenylsulfamoylphenyl)acrylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoate (CAS 412268-99-6) is a chemical compound with the molecular formula C16H15NO4S and a molecular weight of 317.4 g/mol. IUPAC name: methyl (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoate. InChIKey: DHTBNYJTBNLKDO-ZHACJKMWSA-N.
| Molecular formula | C16H15NO4S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | methyl (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoate |
| InChIKey | DHTBNYJTBNLKDO-ZHACJKMWSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CC=C1)S(=O)(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3-(3-Phenylsulfamoylphenyl)acrylic acid methyl ester, (E)-methyl 3-(3-(N-phenylsulfamoyl)phenyl)acrylate, methyl (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoate, Phenylsulfamoylphenyl)acrylic acid methyl ester, 3-(3-Phenylsulfamoylphenyl)acrylicacidmethylester, methyl (2E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enoate