Products 106871-55-0
CAS 106871-55-0 is the registry number for β-Glucosyl indole-3-carboxylate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1H-indole-3-carboxylate (CAS 106871-55-0) is a chemical compound with the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. IUPAC name: [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1H-indole-3-carboxylate. InChIKey: OQZPHKHJQADXAS-VVSAWPALSA-N.
| Molecular formula | C15H17NO7 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1H-indole-3-carboxylate |
| InChIKey | OQZPHKHJQADXAS-VVSAWPALSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)