Products 245660-13-3
CAS 245660-13-3 appears in our catalog under these names: EpoY, EpoY, 99.80%. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 50 mg, 25 mg, 10mM/1mL, 10 mg, 5 mg.
(2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid (CAS 245660-13-3) is a chemical compound with the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. IUPAC name: (2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid. InChIKey: PSLWNPKMALERSK-SRVKXCTJSA-N.
| Molecular formula | C15H17NO7 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | PSLWNPKMALERSK-SRVKXCTJSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)