CAS 1357599-84-8 is the registry number for 1,4-Dimethyl N-((2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl)-L-aspartate. Offered by: TRC. Available pack sizes: 500mg.
Dimethyl (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioate (CAS 1357599-84-8) is a chemical compound with the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. IUPAC name: dimethyl (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioate. InChIKey: BCZOZPJEPHTSJK-RWCYGVJQSA-N.
| Molecular formula | C15H17NO7 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | dimethyl (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioate |
| InChIKey | BCZOZPJEPHTSJK-RWCYGVJQSA-N |
| SMILES | COC(=O)C[C@@H](C(=O)OC)NC(=O)/C=C/C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)