CAS 106877-22-9 is the registry number for 3,6-Bis(trifluoromethyl)benzene-1,2-diamine. Offered by: TRC. Available pack sizes: 500mg.
3,6-bis(trifluoromethyl)benzene-1,2-diamine (CAS 106877-22-9) is a chemical compound with the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. IUPAC name: 3,6-bis(trifluoromethyl)benzene-1,2-diamine. InChIKey: YCMVMJWWGVVLDD-UHFFFAOYSA-N.
| Molecular formula | C8H6F6N2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 3,6-bis(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | YCMVMJWWGVVLDD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)N)N)C(F)(F)F |
Computed by PubChem (NCBI)